![3-[(3,3-dimethyl-4H-isoquinolin-1-yl)amino]propanoic acid (CAS: 187884-87-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0707453.png "3-[(3,3-dimethyl-4H-isoquinolin-1-yl)amino]propanoic acid chemical structure")
3-[(3,3-dimethyl-4H-isoquinolin-1-yl)amino]propanoic acid
Catalog No: FT-0707453
CAS No: 187884-87-3
- Chemical Name: 3-[(3,3-dimethyl-4H-isoquinolin-1-yl)amino]propanoic acid
- Molecular Formula: C14H18N2O2
- Molecular Weight: 246.3
- InChI Key: KHJUAUGETKHIEI-UHFFFAOYSA-N
- InChI: InChI=1S/C14H18N2O2/c1-14(2)9-10-5-3-4-6-11(10)13(16-14)15-8-7-12(17)18/h3-6H,7-9H2,1-2H3,(H,15,16)(H,17,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 246.30500 |
| CAS: | 187884-87-3 |
| MF: | C14H18N2O2 |
| Flash_Point: | 232.9ºC |
| Product_Name: | 3-[(3,3-dimethyl-4H-isoquinolin-1-yl)amino]propanoic acid |
| Bolling_Point: | 461.4ºC at 760 mmHg |
| Density: | 1.18g/cm3 |
| FW: | 246.30500 |
|---|---|
| Refractive_Index: | 1.585 |
| Vapor_Pressure: | 2.6E-09mmHg at 25°C |
| MF: | C14H18N2O2 |
| Exact_Mass: | 246.13700 |
| LogP: | 1.65870 |
| Bolling_Point: | 461.4ºC at 760 mmHg |
| Density: | 1.18g/cm3 |
| PSA: | 61.69000 |
| Flash_Point: | 232.9ºC |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)